C21H23N5O3 — CID 109067228
3-N-(3-acetamidophenyl)-1-N-butylimidazo[1,5-a]pyridine-1,3-dicarboxamide (PubChem CID 109067228) has the molecular formula C21H23N5O3 and a molecular weight of 393.45 g/mol. Its IUPAC name is 3-N-(3-acetamidophenyl)-1-N-butylimidazo[1,5-a]pyridine-1,3-dicarboxamide.
| Compound Name | 3-N-(3-acetamidophenyl)-1-N-butylimidazo[1,5-a]pyridine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109067228 |
| Molecular Formula | C21H23N5O3 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | 3-N-(3-acetamidophenyl)-1-N-butylimidazo[1,5-a]pyridine-1,3-dicarboxamide |
| SMILES | CCCCNC(=O)c1nc(C(=O)Nc2cccc(NC(C)=O)c2)n2ccccc12 |
| InChI | InChI=1S/C21H23N5O3/c1-3-4-11-22-20(28)18-17-10-5-6-12-26(17)19(25-18)21(29)24-16-9-7-8-15(13-16)23-14(2)27/h5-10,12-13H,3-4,11H2,1-2H3,(H,22,28)(H,23,27)(H,24,29) |
| InChIKey | OZGBXSJJXXVARD-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 104.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|