C17H24N4O2 — CID 109067169
1-N-butyl-3-N-tert-butylimidazo[1,5-a]pyridine-1,3-dicarboxamide (PubChem CID 109067169) has the molecular formula C17H24N4O2 and a molecular weight of 316.41 g/mol. Its IUPAC name is 1-N-butyl-3-N-tert-butylimidazo[1,5-a]pyridine-1,3-dicarboxamide.
| Compound Name | 1-N-butyl-3-N-tert-butylimidazo[1,5-a]pyridine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109067169 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 1-N-butyl-3-N-tert-butylimidazo[1,5-a]pyridine-1,3-dicarboxamide |
| SMILES | CCCCNC(=O)c1nc(C(=O)NC(C)(C)C)n2ccccc12 |
| InChI | InChI=1S/C17H24N4O2/c1-5-6-10-18-15(22)13-12-9-7-8-11-21(12)14(19-13)16(23)20-17(2,3)4/h7-9,11H,5-6,10H2,1-4H3,(H,18,22)(H,20,23) |
| InChIKey | DJHCHGJXZPCRSH-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 75.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|