C21H22N4O3 — CID 109067357
1-N-(4-acetylphenyl)-3-N-butylimidazo[1,5-a]pyridine-1,3-dicarboxamide (PubChem CID 109067357) has the molecular formula C21H22N4O3 and a molecular weight of 378.43 g/mol. Its IUPAC name is 1-N-(4-acetylphenyl)-3-N-butylimidazo[1,5-a]pyridine-1,3-dicarboxamide.
| Compound Name | 1-N-(4-acetylphenyl)-3-N-butylimidazo[1,5-a]pyridine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109067357 |
| Molecular Formula | C21H22N4O3 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 1-N-(4-acetylphenyl)-3-N-butylimidazo[1,5-a]pyridine-1,3-dicarboxamide |
| SMILES | CCCCNC(=O)c1nc(C(=O)Nc2ccc(C(C)=O)cc2)c2ccccn12 |
| InChI | InChI=1S/C21H22N4O3/c1-3-4-12-22-21(28)19-24-18(17-7-5-6-13-25(17)19)20(27)23-16-10-8-15(9-11-16)14(2)26/h5-11,13H,3-4,12H2,1-2H3,(H,22,28)(H,23,27) |
| InChIKey | VWPFNOPYJACYMX-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 92.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|