C17H25N5O2 — CID 109067130
1-N-butyl-3-N-[2-(dimethylamino)ethyl]imidazo[1,5-a]pyridine-1,3-dicarboxamide (PubChem CID 109067130) has the molecular formula C17H25N5O2 and a molecular weight of 331.42 g/mol. Its IUPAC name is 1-N-butyl-3-N-[2-(dimethylamino)ethyl]imidazo[1,5-a]pyridine-1,3-dicarboxamide.
| Compound Name | 1-N-butyl-3-N-[2-(dimethylamino)ethyl]imidazo[1,5-a]pyridine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109067130 |
| Molecular Formula | C17H25N5O2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | 1-N-butyl-3-N-[2-(dimethylamino)ethyl]imidazo[1,5-a]pyridine-1,3-dicarboxamide |
| SMILES | CCCCNC(=O)c1nc(C(=O)NCCN(C)C)n2ccccc12 |
| InChI | InChI=1S/C17H25N5O2/c1-4-5-9-18-16(23)14-13-8-6-7-11-22(13)15(20-14)17(24)19-10-12-21(2)3/h6-8,11H,4-5,9-10,12H2,1-3H3,(H,18,23)(H,19,24) |
| InChIKey | WONGAAVKWGJXHS-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 78.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|