C21H25N5O2 — CID 109069795
1-N-[3-(dimethylamino)propyl]-3-N-(3-methylphenyl)imidazo[1,5-a]pyridine-1,3-dicarboxamide (PubChem CID 109069795) has the molecular formula C21H25N5O2 and a molecular weight of 379.46 g/mol. Its IUPAC name is 1-N-[3-(dimethylamino)propyl]-3-N-(3-methylphenyl)imidazo[1,5-a]pyridine-1,3-dicarboxamide.
| Compound Name | 1-N-[3-(dimethylamino)propyl]-3-N-(3-methylphenyl)imidazo[1,5-a]pyridine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109069795 |
| Molecular Formula | C21H25N5O2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | 1-N-[3-(dimethylamino)propyl]-3-N-(3-methylphenyl)imidazo[1,5-a]pyridine-1,3-dicarboxamide |
| SMILES | Cc1cccc(NC(=O)c2nc(C(=O)NCCCN(C)C)c3ccccn23)c1 |
| InChI | InChI=1S/C21H25N5O2/c1-15-8-6-9-16(14-15)23-21(28)19-24-18(17-10-4-5-13-26(17)19)20(27)22-11-7-12-25(2)3/h4-6,8-10,13-14H,7,11-12H2,1-3H3,(H,22,27)(H,23,28) |
| InChIKey | JSHCSSJPISQFOE-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 78.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|