C17H18N4O4 — CID 109068870
3-N-(furan-2-ylmethyl)-1-N-(2-methoxyethyl)imidazo[1,5-a]pyridine-1,3-dicarboxamide (PubChem CID 109068870) has the molecular formula C17H18N4O4 and a molecular weight of 342.36 g/mol. Its IUPAC name is 3-N-(furan-2-ylmethyl)-1-N-(2-methoxyethyl)imidazo[1,5-a]pyridine-1,3-dicarboxamide.
| Compound Name | 3-N-(furan-2-ylmethyl)-1-N-(2-methoxyethyl)imidazo[1,5-a]pyridine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109068870 |
| Molecular Formula | C17H18N4O4 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 3-N-(furan-2-ylmethyl)-1-N-(2-methoxyethyl)imidazo[1,5-a]pyridine-1,3-dicarboxamide |
| SMILES | COCCNC(=O)c1nc(C(=O)NCc2ccco2)n2ccccc12 |
| InChI | InChI=1S/C17H18N4O4/c1-24-10-7-18-16(22)14-13-6-2-3-8-21(13)15(20-14)17(23)19-11-12-5-4-9-25-12/h2-6,8-9H,7,10-11H2,1H3,(H,18,22)(H,19,23) |
| InChIKey | KGTMZZUDRCAMRH-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 97.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|