C20H22N4O3 — CID 109068926
3-N-ethyl-1-N-(2-methoxyethyl)-3-N-phenylimidazo[1,5-a]pyridine-1,3-dicarboxamide (PubChem CID 109068926) has the molecular formula C20H22N4O3 and a molecular weight of 366.42 g/mol. Its IUPAC name is 3-N-ethyl-1-N-(2-methoxyethyl)-3-N-phenylimidazo[1,5-a]pyridine-1,3-dicarboxamide.
| Compound Name | 3-N-ethyl-1-N-(2-methoxyethyl)-3-N-phenylimidazo[1,5-a]pyridine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109068926 |
| Molecular Formula | C20H22N4O3 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 3-N-ethyl-1-N-(2-methoxyethyl)-3-N-phenylimidazo[1,5-a]pyridine-1,3-dicarboxamide |
| SMILES | CCN(C(=O)c1nc(C(=O)NCCOC)c2ccccn12)c1ccccc1 |
| InChI | InChI=1S/C20H22N4O3/c1-3-23(15-9-5-4-6-10-15)20(26)18-22-17(19(25)21-12-14-27-2)16-11-7-8-13-24(16)18/h4-11,13H,3,12,14H2,1-2H3,(H,21,25) |
| InChIKey | JHZJKGDWZSNQJY-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|