C22H24N4O3 — CID 109069144
3-(3,4-dihydro-2H-quinoline-1-carbonyl)-N-(3-methoxypropyl)imidazo[1,5-a]pyridine-1-carboxamide (PubChem CID 109069144) has the molecular formula C22H24N4O3 and a molecular weight of 392.46 g/mol. Its IUPAC name is 3-(3,4-dihydro-2H-quinoline-1-carbonyl)-N-(3-methoxypropyl)imidazo[1,5-a]pyridine-1-carboxamide.
| Compound Name | 3-(3,4-dihydro-2H-quinoline-1-carbonyl)-N-(3-methoxypropyl)imidazo[1,5-a]pyridine-1-carboxamide |
|---|---|
| PubChem CID | 109069144 |
| Molecular Formula | C22H24N4O3 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 3-(3,4-dihydro-2H-quinoline-1-carbonyl)-N-(3-methoxypropyl)imidazo[1,5-a]pyridine-1-carboxamide |
| SMILES | COCCCNC(=O)c1nc(C(=O)N2CCCc3ccccc32)n2ccccc12 |
| InChI | InChI=1S/C22H24N4O3/c1-29-15-7-12-23-21(27)19-18-11-4-5-13-25(18)20(24-19)22(28)26-14-6-9-16-8-2-3-10-17(16)26/h2-5,8,10-11,13H,6-7,9,12,14-15H2,1H3,(H,23,27) |
| InChIKey | FDKKZIOHMRLKAA-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|