C18H24N2O3 — CID 109133166
2-(3,4-dihydro-2H-quinoline-1-carbonyl)-N-(3-methoxypropyl)cyclopropane-1-carboxamide (PubChem CID 109133166) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-quinoline-1-carbonyl)-N-(3-methoxypropyl)cyclopropane-1-carboxamide.
| Compound Name | 2-(3,4-dihydro-2H-quinoline-1-carbonyl)-N-(3-methoxypropyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 109133166 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | 2-(3,4-dihydro-2H-quinoline-1-carbonyl)-N-(3-methoxypropyl)cyclopropane-1-carboxamide |
| SMILES | COCCCNC(=O)C1CC1C(=O)N1CCCc2ccccc21 |
| InChI | InChI=1S/C18H24N2O3/c1-23-11-5-9-19-17(21)14-12-15(14)18(22)20-10-4-7-13-6-2-3-8-16(13)20/h2-3,6,8,14-15H,4-5,7,9-12H2,1H3,(H,19,21) |
| InChIKey | UXWBOTSQYQYXIK-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|