C17H22N2O3 — CID 109133165
2-(2,3-dihydroindole-1-carbonyl)-N-(3-methoxypropyl)cyclopropane-1-carboxamide (PubChem CID 109133165) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is 2-(2,3-dihydroindole-1-carbonyl)-N-(3-methoxypropyl)cyclopropane-1-carboxamide.
| Compound Name | 2-(2,3-dihydroindole-1-carbonyl)-N-(3-methoxypropyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 109133165 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 2-(2,3-dihydroindole-1-carbonyl)-N-(3-methoxypropyl)cyclopropane-1-carboxamide |
| SMILES | COCCCNC(=O)C1CC1C(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C17H22N2O3/c1-22-10-4-8-18-16(20)13-11-14(13)17(21)19-9-7-12-5-2-3-6-15(12)19/h2-3,5-6,13-14H,4,7-11H2,1H3,(H,18,20) |
| InChIKey | KQBHBWMOEKREOH-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|