C22H21N5O2 — CID 109071122
1-N-tert-butyl-3-N-quinolin-8-ylimidazo[1,5-a]pyridine-1,3-dicarboxamide (PubChem CID 109071122) has the molecular formula C22H21N5O2 and a molecular weight of 387.44 g/mol. Its IUPAC name is 1-N-tert-butyl-3-N-quinolin-8-ylimidazo[1,5-a]pyridine-1,3-dicarboxamide.
| Compound Name | 1-N-tert-butyl-3-N-quinolin-8-ylimidazo[1,5-a]pyridine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109071122 |
| Molecular Formula | C22H21N5O2 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 1-N-tert-butyl-3-N-quinolin-8-ylimidazo[1,5-a]pyridine-1,3-dicarboxamide |
| SMILES | CC(C)(C)NC(=O)c1nc(C(=O)Nc2cccc3cccnc23)n2ccccc12 |
| InChI | InChI=1S/C22H21N5O2/c1-22(2,3)26-20(28)18-16-11-4-5-13-27(16)19(25-18)21(29)24-15-10-6-8-14-9-7-12-23-17(14)15/h4-13H,1-3H3,(H,24,29)(H,26,28) |
| InChIKey | HIKNDJYZQNAERT-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 88.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |