C20H24N4O4 — CID 109073299
1-N-(3,4-dimethoxyphenyl)-3-N-prop-2-enyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide (PubChem CID 109073299) has the molecular formula C20H24N4O4 and a molecular weight of 384.44 g/mol. Its IUPAC name is 1-N-(3,4-dimethoxyphenyl)-3-N-prop-2-enyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide.
| Compound Name | 1-N-(3,4-dimethoxyphenyl)-3-N-prop-2-enyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109073299 |
| Molecular Formula | C20H24N4O4 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 1-N-(3,4-dimethoxyphenyl)-3-N-prop-2-enyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide |
| SMILES | C=CCNC(=O)c1nc(C(=O)Nc2ccc(OC)c(OC)c2)c2n1CCCC2 |
| InChI | InChI=1S/C20H24N4O4/c1-4-10-21-20(26)18-23-17(14-7-5-6-11-24(14)18)19(25)22-13-8-9-15(27-2)16(12-13)28-3/h4,8-9,12H,1,5-7,10-11H2,2-3H3,(H,21,26)(H,22,25) |
| InChIKey | ZUKTUXJPEVPMIV-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|