C19H23ClN4O3 — CID 109075144
1-N-(3-chloro-4-methylphenyl)-3-N-(2-methoxyethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide (PubChem CID 109075144) has the molecular formula C19H23ClN4O3 and a molecular weight of 390.87 g/mol. Its IUPAC name is 1-N-(3-chloro-4-methylphenyl)-3-N-(2-methoxyethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide.
| Compound Name | 1-N-(3-chloro-4-methylphenyl)-3-N-(2-methoxyethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109075144 |
| Molecular Formula | C19H23ClN4O3 |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | 1-N-(3-chloro-4-methylphenyl)-3-N-(2-methoxyethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide |
| SMILES | COCCNC(=O)c1nc(C(=O)Nc2ccc(C)c(Cl)c2)c2n1CCCC2 |
| InChI | InChI=1S/C19H23ClN4O3/c1-12-6-7-13(11-14(12)20)22-18(25)16-15-5-3-4-9-24(15)17(23-16)19(26)21-8-10-27-2/h6-7,11H,3-5,8-10H2,1-2H3,(H,21,26)(H,22,25) |
| InChIKey | SMXQRNAQKNDSHH-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|