C20H24N4O4 — CID 109075047
3-N-(3-acetylphenyl)-1-N-(2-methoxyethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide (PubChem CID 109075047) has the molecular formula C20H24N4O4 and a molecular weight of 384.44 g/mol. Its IUPAC name is 3-N-(3-acetylphenyl)-1-N-(2-methoxyethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide.
| Compound Name | 3-N-(3-acetylphenyl)-1-N-(2-methoxyethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109075047 |
| Molecular Formula | C20H24N4O4 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 3-N-(3-acetylphenyl)-1-N-(2-methoxyethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide |
| SMILES | COCCNC(=O)c1nc(C(=O)Nc2cccc(C(C)=O)c2)n2c1CCCC2 |
| InChI | InChI=1S/C20H24N4O4/c1-13(25)14-6-5-7-15(12-14)22-20(27)18-23-17(19(26)21-9-11-28-2)16-8-3-4-10-24(16)18/h5-7,12H,3-4,8-11H2,1-2H3,(H,21,26)(H,22,27) |
| InChIKey | UXWPSSYNBWXUMK-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|