C21H32N4O2 — CID 109073837
1-N-butan-2-yl-3-N-[2-(cyclohexen-1-yl)ethyl]-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide (PubChem CID 109073837) has the molecular formula C21H32N4O2 and a molecular weight of 372.51 g/mol. Its IUPAC name is 1-N-butan-2-yl-3-N-[2-(cyclohexen-1-yl)ethyl]-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide.
| Compound Name | 1-N-butan-2-yl-3-N-[2-(cyclohexen-1-yl)ethyl]-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109073837 |
| Molecular Formula | C21H32N4O2 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | 1-N-butan-2-yl-3-N-[2-(cyclohexen-1-yl)ethyl]-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide |
| SMILES | CCC(C)NC(=O)c1nc(C(=O)NCCC2=CCCCC2)n2c1CCCC2 |
| InChI | InChI=1S/C21H32N4O2/c1-3-15(2)23-20(26)18-17-11-7-8-14-25(17)19(24-18)21(27)22-13-12-16-9-5-4-6-10-16/h9,15H,3-8,10-14H2,1-2H3,(H,22,27)(H,23,26) |
| InChIKey | PMBRNGCBVPRDKO-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|