C22H34N4O2 — CID 109074952
3-N-[2-(cyclohexen-1-yl)ethyl]-1-N-(3-methylbutyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide (PubChem CID 109074952) has the molecular formula C22H34N4O2 and a molecular weight of 386.54 g/mol. Its IUPAC name is 3-N-[2-(cyclohexen-1-yl)ethyl]-1-N-(3-methylbutyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide.
| Compound Name | 3-N-[2-(cyclohexen-1-yl)ethyl]-1-N-(3-methylbutyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109074952 |
| Molecular Formula | C22H34N4O2 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.27 |
| IUPAC Name | 3-N-[2-(cyclohexen-1-yl)ethyl]-1-N-(3-methylbutyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide |
| SMILES | CC(C)CCNC(=O)c1nc(C(=O)NCCC2=CCCCC2)n2c1CCCC2 |
| InChI | InChI=1S/C22H34N4O2/c1-16(2)11-13-23-21(27)19-18-10-6-7-15-26(18)20(25-19)22(28)24-14-12-17-8-4-3-5-9-17/h8,16H,3-7,9-15H2,1-2H3,(H,23,27)(H,24,28) |
| InChIKey | QMNAOFPVZCXBIM-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|