C32H30N6O2 — CID 10907552
N,1-bis[(3-carbamimidoylphenyl)methyl]-5-phenylmethoxyindole-2-carboxamide (PubChem CID 10907552) has the molecular formula C32H30N6O2 and a molecular weight of 530.63 g/mol. Its IUPAC name is N,1-bis[(3-carbamimidoylphenyl)methyl]-5-phenylmethoxyindole-2-carboxamide.
| Compound Name | N,1-bis[(3-carbamimidoylphenyl)methyl]-5-phenylmethoxyindole-2-carboxamide |
|---|---|
| PubChem CID | 10907552 |
| Molecular Formula | C32H30N6O2 |
| Molecular Weight | 530.63 g/mol |
| Exact Mass | 530.24 |
| IUPAC Name | N,1-bis[(3-carbamimidoylphenyl)methyl]-5-phenylmethoxyindole-2-carboxamide |
| SMILES | [H]/N=C(\N)c1cccc(CNC(=O)c2cc3cc(OCc4ccccc4)ccc3n2Cc2cccc(/C(N)=N/[H])c2)c1 |
| InChI | InChI=1S/C32H30N6O2/c33-30(34)24-10-4-8-22(14-24)18-37-32(39)29-17-26-16-27(40-20-21-6-2-1-3-7-21)12-13-28(26)38(29)19-23-9-5-11-25(15-23)31(35)36/h1-17H,18-20H2,(H3,33,34)(H3,35,36)(H,37,39) |
| InChIKey | DMUWRNDTNGVXSO-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 143.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.63 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|