C17H29N5O2 — CID 109075704
3-N-[2-(dimethylamino)ethyl]-1-N,1-N-diethyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide (PubChem CID 109075704) has the molecular formula C17H29N5O2 and a molecular weight of 335.45 g/mol. Its IUPAC name is 3-N-[2-(dimethylamino)ethyl]-1-N,1-N-diethyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide.
| Compound Name | 3-N-[2-(dimethylamino)ethyl]-1-N,1-N-diethyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109075704 |
| Molecular Formula | C17H29N5O2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.23 |
| IUPAC Name | 3-N-[2-(dimethylamino)ethyl]-1-N,1-N-diethyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide |
| SMILES | CCN(CC)C(=O)c1nc(C(=O)NCCN(C)C)n2c1CCCC2 |
| InChI | InChI=1S/C17H29N5O2/c1-5-21(6-2)17(24)14-13-9-7-8-11-22(13)15(19-14)16(23)18-10-12-20(3)4/h5-12H2,1-4H3,(H,18,23) |
| InChIKey | PGOCSOJXVQJEKP-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |