C21H30N6O2 — CID 109075748
3-N-[2-(dimethylamino)ethyl]-1-N-[4-(dimethylamino)phenyl]-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide (PubChem CID 109075748) has the molecular formula C21H30N6O2 and a molecular weight of 398.51 g/mol. Its IUPAC name is 3-N-[2-(dimethylamino)ethyl]-1-N-[4-(dimethylamino)phenyl]-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide.
| Compound Name | 3-N-[2-(dimethylamino)ethyl]-1-N-[4-(dimethylamino)phenyl]-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109075748 |
| Molecular Formula | C21H30N6O2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.24 |
| IUPAC Name | 3-N-[2-(dimethylamino)ethyl]-1-N-[4-(dimethylamino)phenyl]-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide |
| SMILES | CN(C)CCNC(=O)c1nc(C(=O)Nc2ccc(N(C)C)cc2)c2n1CCCC2 |
| InChI | InChI=1S/C21H30N6O2/c1-25(2)14-12-22-21(29)19-24-18(17-7-5-6-13-27(17)19)20(28)23-15-8-10-16(11-9-15)26(3)4/h8-11H,5-7,12-14H2,1-4H3,(H,22,29)(H,23,28) |
| InChIKey | ALHSCDFSHFRIQO-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 82.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|