C36H39O2P — CID 10907591
1-butyl-5-(diphenylphosphorylmethyl)-2-hex-1-ynyl-3-(4-methoxyphenyl)benzene (PubChem CID 10907591) has the molecular formula C36H39O2P and a molecular weight of 534.68 g/mol. Its IUPAC name is 1-butyl-5-(diphenylphosphorylmethyl)-2-hex-1-ynyl-3-(4-methoxyphenyl)benzene.
| Compound Name | 1-butyl-5-(diphenylphosphorylmethyl)-2-hex-1-ynyl-3-(4-methoxyphenyl)benzene |
|---|---|
| PubChem CID | 10907591 |
| Molecular Formula | C36H39O2P |
| Molecular Weight | 534.68 g/mol |
| Exact Mass | 534.27 |
| IUPAC Name | 1-butyl-5-(diphenylphosphorylmethyl)-2-hex-1-ynyl-3-(4-methoxyphenyl)benzene |
| SMILES | CCCCC#Cc1c(CCCC)cc(CP(=O)(c2ccccc2)c2ccccc2)cc1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C36H39O2P/c1-4-6-8-15-21-35-31(16-7-5-2)26-29(27-36(35)30-22-24-32(38-3)25-23-30)28-39(37,33-17-11-9-12-18-33)34-19-13-10-14-20-34/h9-14,17-20,22-27H,4-8,16,28H2,1-3H3 |
| InChIKey | QXQMOTYTXZNVBJ-UHFFFAOYSA-N |
| XLogP | 8.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.68 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|