C20H28NaO4P — CID 174806306
sodium;[4-(2,4-dibutylphenyl)phenyl] dihydrogen phosphate;hydride (PubChem CID 174806306) has the molecular formula C20H28NaO4P and a molecular weight of 386.40 g/mol. Its IUPAC name is sodium;[4-(2,4-dibutylphenyl)phenyl] dihydrogen phosphate;hydride.
| Compound Name | sodium;[4-(2,4-dibutylphenyl)phenyl] dihydrogen phosphate;hydride |
|---|---|
| PubChem CID | 174806306 |
| Molecular Formula | C20H28NaO4P |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | sodium;[4-(2,4-dibutylphenyl)phenyl] dihydrogen phosphate;hydride |
| SMILES | CCCCc1ccc(-c2ccc(OP(=O)(O)O)cc2)c(CCCC)c1.[H-].[Na+] |
| InChI | InChI=1S/C20H27O4P.Na.H/c1-3-5-7-16-9-14-20(18(15-16)8-6-4-2)17-10-12-19(13-11-17)24-25(21,22)23;;/h9-15H,3-8H2,1-2H3,(H2,21,22,23);;/q;+1;-1 |
| InChIKey | UVHNJKRLSNKDPD-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|