C33H56O11P2 — CID 87113401
2-[(2,4-dibutylphenoxy)-(2,4-dibutylphenyl)methyl]-2-(hydroxymethyl)propane-1,3-diol;phosphono dihydrogen phosphate (PubChem CID 87113401) has the molecular formula C33H56O11P2 and a molecular weight of 690.75 g/mol. Its IUPAC name is 2-[(2,4-dibutylphenoxy)-(2,4-dibutylphenyl)methyl]-2-(hydroxymethyl)propane-1,3-diol;phosphono dihydrogen phosphate.
| Compound Name | 2-[(2,4-dibutylphenoxy)-(2,4-dibutylphenyl)methyl]-2-(hydroxymethyl)propane-1,3-diol;phosphono dihydrogen phosphate |
|---|---|
| PubChem CID | 87113401 |
| Molecular Formula | C33H56O11P2 |
| Molecular Weight | 690.75 g/mol |
| Exact Mass | 690.33 |
| IUPAC Name | 2-[(2,4-dibutylphenoxy)-(2,4-dibutylphenyl)methyl]-2-(hydroxymethyl)propane-1,3-diol;phosphono dihydrogen phosphate |
| SMILES | CCCCc1ccc(OC(c2ccc(CCCC)cc2CCCC)C(CO)(CO)CO)c(CCCC)c1.O=P(O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C33H52O4.H4O7P2/c1-5-9-13-26-17-19-30(28(21-26)15-11-7-3)32(33(23-34,24-35)25-36)37-31-20-18-27(14-10-6-2)22-29(31)16-12-8-4;1-8(2,3)7-9(4,5)6/h17-22,32,34-36H,5-16,23-25H2,1-4H3;(H2,1,2,3)(H2,4,5,6) |
| InChIKey | REFXWLOMYNOXFA-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 194.21 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.75 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|