C29H46AlO7P2 — CID 87276783
CID 87276783 (PubChem CID 87276783) has the molecular formula C29H46AlO7P2 and a molecular weight of 595.61 g/mol.
| Compound Name | CID 87276783 |
|---|---|
| PubChem CID | 87276783 |
| Molecular Formula | C29H46AlO7P2 |
| Molecular Weight | 595.61 g/mol |
| Exact Mass | 595.25 |
| IUPAC Name | — |
| SMILES | CCCCc1ccc(C(OP(=O)(O)OP(=O)(O)O)c2ccc(CCCC)cc2CCCC)c(CCCC)c1.[Al] |
| InChI | InChI=1S/C29H46O7P2.Al/c1-5-9-13-23-17-19-27(25(21-23)15-11-7-3)29(35-38(33,34)36-37(30,31)32)28-20-18-24(14-10-6-2)22-26(28)16-12-8-4;/h17-22,29H,5-16H2,1-4H3,(H,33,34)(H2,30,31,32); |
| InChIKey | OMQGMBGJCVLFEP-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.61 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|