C22H23O3P — CID 141245968
[4-(4-butylphenyl)phenyl]-phenoxyphosphinic acid (PubChem CID 141245968) has the molecular formula C22H23O3P and a molecular weight of 366.40 g/mol. Its IUPAC name is [4-(4-butylphenyl)phenyl]-phenoxyphosphinic acid.
| Compound Name | [4-(4-butylphenyl)phenyl]-phenoxyphosphinic acid |
|---|---|
| PubChem CID | 141245968 |
| Molecular Formula | C22H23O3P |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | [4-(4-butylphenyl)phenyl]-phenoxyphosphinic acid |
| SMILES | CCCCc1ccc(-c2ccc(P(=O)(O)Oc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C22H23O3P/c1-2-3-7-18-10-12-19(13-11-18)20-14-16-22(17-15-20)26(23,24)25-21-8-5-4-6-9-21/h4-6,8-17H,2-3,7H2,1H3,(H,23,24) |
| InChIKey | NNEKRGIFFPFSSP-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|