About phenoxy(phenyl)phosphinic acid;phosphenous acid
phenoxy(phenyl)phosphinic acid;phosphenous acid (PubChem CID 174870906) has the molecular formula C12H12O5P2
and a molecular weight of 298.17 g/mol. Its IUPAC name is phenoxy(phenyl)phosphinic acid;phosphenous acid.
Molecular Properties
| Compound Name | phenoxy(phenyl)phosphinic acid;phosphenous acid |
| PubChem CID | 174870906 |
| Molecular Formula | C12H12O5P2 |
| Molecular Weight | 298.17 g/mol |
| Exact Mass | 298.02 |
| IUPAC Name | phenoxy(phenyl)phosphinic acid;phosphenous acid |
| SMILES | O=P(O)(Oc1ccccc1)c1ccccc1.O=PO |
| InChI | InChI=1S/C12H11O3P.HO2P/c13-16(14,12-9-5-2-6-10-12)15-11-7-3-1-4-8-11;1-3-2/h1-10H,(H,13,14);(H,1,2) |
| InChIKey | NTMPEPBPMONIEU-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.17 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze phenoxy(phenyl)phosphinic acid;phosphenous acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenoxy(phenyl)phosphinic acid;phosphenous acid?
The IUPAC name of phenoxy(phenyl)phosphinic acid;phosphenous acid (CID 174870906) is phenoxy(phenyl)phosphinic acid;phosphenous acid.
What is the SMILES notation for phenoxy(phenyl)phosphinic acid;phosphenous acid?
The canonical SMILES for phenoxy(phenyl)phosphinic acid;phosphenous acid is O=P(O)(Oc1ccccc1)c1ccccc1.O=PO.
What is the InChIKey of phenoxy(phenyl)phosphinic acid;phosphenous acid?
The InChIKey is NTMPEPBPMONIEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11O3P.HO2P/c13-16(14,12-9-5-2-6-10-12)15-11-7-3-1-4-8-11;1-3-2/h1-10H,(H,13,14);(H,1,2).
What are the key properties of phenoxy(phenyl)phosphinic acid;phosphenous acid?
phenoxy(phenyl)phosphinic acid;phosphenous acid has a molecular weight of 298.17 g/mol, XLogP of 2.76, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phenoxy(phenyl)phosphinic acid;phosphenous acid is sourced from PubChem (CID 174870906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).