C21H21O3P — CID 141076733
phenoxy-[4-(2,3,4-trimethylphenyl)phenyl]phosphinic acid (PubChem CID 141076733) has the molecular formula C21H21O3P and a molecular weight of 352.37 g/mol. Its IUPAC name is phenoxy-[4-(2,3,4-trimethylphenyl)phenyl]phosphinic acid.
| Compound Name | phenoxy-[4-(2,3,4-trimethylphenyl)phenyl]phosphinic acid |
|---|---|
| PubChem CID | 141076733 |
| Molecular Formula | C21H21O3P |
| Molecular Weight | 352.37 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | phenoxy-[4-(2,3,4-trimethylphenyl)phenyl]phosphinic acid |
| SMILES | Cc1ccc(-c2ccc(P(=O)(O)Oc3ccccc3)cc2)c(C)c1C |
| InChI | InChI=1S/C21H21O3P/c1-15-9-14-21(17(3)16(15)2)18-10-12-20(13-11-18)25(22,23)24-19-7-5-4-6-8-19/h4-14H,1-3H3,(H,22,23) |
| InChIKey | YCONAOBWVSFGDJ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.37 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|