C23H21N5O2 — CID 109076224
3-N-benzyl-1-N-(4-cyanophenyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide (PubChem CID 109076224) has the molecular formula C23H21N5O2 and a molecular weight of 399.45 g/mol. Its IUPAC name is 3-N-benzyl-1-N-(4-cyanophenyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide.
| Compound Name | 3-N-benzyl-1-N-(4-cyanophenyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109076224 |
| Molecular Formula | C23H21N5O2 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 3-N-benzyl-1-N-(4-cyanophenyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide |
| SMILES | N#Cc1ccc(NC(=O)c2nc(C(=O)NCc3ccccc3)n3c2CCCC3)cc1 |
| InChI | InChI=1S/C23H21N5O2/c24-14-16-9-11-18(12-10-16)26-22(29)20-19-8-4-5-13-28(19)21(27-20)23(30)25-15-17-6-2-1-3-7-17/h1-3,6-7,9-12H,4-5,8,13,15H2,(H,25,30)(H,26,29) |
| InChIKey | WSVMVLYFKGXCGX-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 99.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |