C20H23N5O2 — CID 109076675
3-N-(4-cyanophenyl)-1-N,1-N-diethyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide (PubChem CID 109076675) has the molecular formula C20H23N5O2 and a molecular weight of 365.44 g/mol. Its IUPAC name is 3-N-(4-cyanophenyl)-1-N,1-N-diethyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide.
| Compound Name | 3-N-(4-cyanophenyl)-1-N,1-N-diethyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109076675 |
| Molecular Formula | C20H23N5O2 |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | 3-N-(4-cyanophenyl)-1-N,1-N-diethyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide |
| SMILES | CCN(CC)C(=O)c1nc(C(=O)Nc2ccc(C#N)cc2)n2c1CCCC2 |
| InChI | InChI=1S/C20H23N5O2/c1-3-24(4-2)20(27)17-16-7-5-6-12-25(16)18(23-17)19(26)22-15-10-8-14(13-21)9-11-15/h8-11H,3-7,12H2,1-2H3,(H,22,26) |
| InChIKey | DBCOPOWEGFFJOY-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 91.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |