C22H30N4O2 — CID 109076793
1-N-tert-butyl-3-N-(2,4,6-trimethylphenyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide (PubChem CID 109076793) has the molecular formula C22H30N4O2 and a molecular weight of 382.51 g/mol. Its IUPAC name is 1-N-tert-butyl-3-N-(2,4,6-trimethylphenyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide.
| Compound Name | 1-N-tert-butyl-3-N-(2,4,6-trimethylphenyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109076793 |
| Molecular Formula | C22H30N4O2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | 1-N-tert-butyl-3-N-(2,4,6-trimethylphenyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide |
| SMILES | Cc1cc(C)c(NC(=O)c2nc(C(=O)NC(C)(C)C)c3n2CCCC3)c(C)c1 |
| InChI | InChI=1S/C22H30N4O2/c1-13-11-14(2)17(15(3)12-13)24-21(28)19-23-18(20(27)25-22(4,5)6)16-9-7-8-10-26(16)19/h11-12H,7-10H2,1-6H3,(H,24,28)(H,25,27) |
| InChIKey | XIPHJUASGQNVRV-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |