C20H24N4O4 — CID 109076825
3-N-(1,3-benzodioxol-5-yl)-1-N-tert-butyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide (PubChem CID 109076825) has the molecular formula C20H24N4O4 and a molecular weight of 384.44 g/mol. Its IUPAC name is 3-N-(1,3-benzodioxol-5-yl)-1-N-tert-butyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide.
| Compound Name | 3-N-(1,3-benzodioxol-5-yl)-1-N-tert-butyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109076825 |
| Molecular Formula | C20H24N4O4 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 3-N-(1,3-benzodioxol-5-yl)-1-N-tert-butyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide |
| SMILES | CC(C)(C)NC(=O)c1nc(C(=O)Nc2ccc3c(c2)OCO3)n2c1CCCC2 |
| InChI | InChI=1S/C20H24N4O4/c1-20(2,3)23-18(25)16-13-6-4-5-9-24(13)17(22-16)19(26)21-12-7-8-14-15(10-12)28-11-27-14/h7-8,10H,4-6,9,11H2,1-3H3,(H,21,26)(H,23,25) |
| InChIKey | PWNUESGYTIIBND-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |