C36H36O6 — CID 10907869
(Z)-1,2,3,4-tetrakis[4-(methoxymethyl)phenyl]but-2-ene-1,4-dione (PubChem CID 10907869) has the molecular formula C36H36O6 and a molecular weight of 564.68 g/mol. Its IUPAC name is (Z)-1,2,3,4-tetrakis[4-(methoxymethyl)phenyl]but-2-ene-1,4-dione.
| Compound Name | (Z)-1,2,3,4-tetrakis[4-(methoxymethyl)phenyl]but-2-ene-1,4-dione |
|---|---|
| PubChem CID | 10907869 |
| Molecular Formula | C36H36O6 |
| Molecular Weight | 564.68 g/mol |
| Exact Mass | 564.25 |
| IUPAC Name | (Z)-1,2,3,4-tetrakis[4-(methoxymethyl)phenyl]but-2-ene-1,4-dione |
| SMILES | COCc1ccc(C(=O)/C(=C(\C(=O)c2ccc(COC)cc2)c2ccc(COC)cc2)c2ccc(COC)cc2)cc1 |
| InChI | InChI=1S/C36H36O6/c1-39-21-25-5-13-29(14-6-25)33(35(37)31-17-9-27(10-18-31)23-41-3)34(30-15-7-26(8-16-30)22-40-2)36(38)32-19-11-28(12-20-32)24-42-4/h5-20H,21-24H2,1-4H3/b34-33- |
| InChIKey | GLXSEISHIADAIG-YHZPTAEISA-N |
| XLogP | 6.95 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.68 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|