C28H56N2O9 — CID 10907874
(2R,3S,4S,5R,6R)-2-[(octylamino)methyl]-6-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[(octylamino)methyl]tetrahydropyran-2-yl]oxy-tetrahydropyran-3,4,5-triol (PubChem CID 10907874) has the molecular formula C28H56N2O9 and a molecular weight of 564.80 g/mol. Its IUPAC name is (2R,3S,4S,5R,6R)-2-[(octylamino)methyl]-6-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[(octylamino)methyl]oxan-2-yl]oxyoxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6R)-2-[(octylamino)methyl]-6-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[(octylamino)methyl]tetrahydropyran-2-yl]oxy-tetrahydropyran-3,4,5-triol |
|---|---|
| PubChem CID | 10907874 |
| Molecular Formula | C28H56N2O9 |
| Molecular Weight | 564.80 g/mol |
| Exact Mass | 564.40 |
| IUPAC Name | (2R,3S,4S,5R,6R)-2-[(octylamino)methyl]-6-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[(octylamino)methyl]oxan-2-yl]oxyoxane-3,4,5-triol |
| SMILES | CCCCCCCCNC[C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)O[C@@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CNCCCCCCCC)O)O)O)O)O)O |
| InChI | InChI=1S/C28H56N2O9/c1-3-5-7-9-11-13-15-29-17-19-21(31)23(33)25(35)27(37-19)39-28-26(36)24(34)22(32)20(38-28)18-30-16-14-12-10-8-6-4-2/h19-36H,3-18H2,1-2H3/t19-,20-,21-,22-,23+,24+,25-,26-,27-,28-/m1/s1 |
| InChIKey | OSUPXEYCVMKINH-QACPWNKNSA-N |
| XLogP | 3.20 |
| TPSA | 173.00 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 39 |
| Complexity | 570 |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.80 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|