C18H17Cl2N3O3 — CID 109083381
4-N-(2,6-dichlorophenyl)-2-N-(oxolan-2-ylmethyl)pyridine-2,4-dicarboxamide (PubChem CID 109083381) has the molecular formula C18H17Cl2N3O3 and a molecular weight of 394.26 g/mol. Its IUPAC name is 4-N-(2,6-dichlorophenyl)-2-N-(oxolan-2-ylmethyl)pyridine-2,4-dicarboxamide.
| Compound Name | 4-N-(2,6-dichlorophenyl)-2-N-(oxolan-2-ylmethyl)pyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109083381 |
| Molecular Formula | C18H17Cl2N3O3 |
| Molecular Weight | 394.26 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | 4-N-(2,6-dichlorophenyl)-2-N-(oxolan-2-ylmethyl)pyridine-2,4-dicarboxamide |
| SMILES | O=C(Nc1c(Cl)cccc1Cl)c1ccnc(C(=O)NCC2CCCO2)c1 |
| InChI | InChI=1S/C18H17Cl2N3O3/c19-13-4-1-5-14(20)16(13)23-17(24)11-6-7-21-15(9-11)18(25)22-10-12-3-2-8-26-12/h1,4-7,9,12H,2-3,8,10H2,(H,22,25)(H,23,24) |
| InChIKey | GHMFQEFJVXZQNV-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.26 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |