C19H21N3O3 — CID 109083312
4-N-(4-methylphenyl)-2-N-(oxolan-2-ylmethyl)pyridine-2,4-dicarboxamide (PubChem CID 109083312) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is 4-N-(4-methylphenyl)-2-N-(oxolan-2-ylmethyl)pyridine-2,4-dicarboxamide.
| Compound Name | 4-N-(4-methylphenyl)-2-N-(oxolan-2-ylmethyl)pyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109083312 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 4-N-(4-methylphenyl)-2-N-(oxolan-2-ylmethyl)pyridine-2,4-dicarboxamide |
| SMILES | Cc1ccc(NC(=O)c2ccnc(C(=O)NCC3CCCO3)c2)cc1 |
| InChI | InChI=1S/C19H21N3O3/c1-13-4-6-15(7-5-13)22-18(23)14-8-9-20-17(11-14)19(24)21-12-16-3-2-10-25-16/h4-9,11,16H,2-3,10,12H2,1H3,(H,21,24)(H,22,23) |
| InChIKey | YEDWQXYPSHKRJQ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |