C20H23N3O5 — CID 109083355
4-N-(2,4-dimethoxyphenyl)-2-N-(oxolan-2-ylmethyl)pyridine-2,4-dicarboxamide (PubChem CID 109083355) has the molecular formula C20H23N3O5 and a molecular weight of 385.42 g/mol. Its IUPAC name is 4-N-(2,4-dimethoxyphenyl)-2-N-(oxolan-2-ylmethyl)pyridine-2,4-dicarboxamide.
| Compound Name | 4-N-(2,4-dimethoxyphenyl)-2-N-(oxolan-2-ylmethyl)pyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109083355 |
| Molecular Formula | C20H23N3O5 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | 4-N-(2,4-dimethoxyphenyl)-2-N-(oxolan-2-ylmethyl)pyridine-2,4-dicarboxamide |
| SMILES | COc1ccc(NC(=O)c2ccnc(C(=O)NCC3CCCO3)c2)c(OC)c1 |
| InChI | InChI=1S/C20H23N3O5/c1-26-14-5-6-16(18(11-14)27-2)23-19(24)13-7-8-21-17(10-13)20(25)22-12-15-4-3-9-28-15/h5-8,10-11,15H,3-4,9,12H2,1-2H3,(H,22,25)(H,23,24) |
| InChIKey | LARPAPMRMKCPGD-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 98.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |