C19H23N3O4 — CID 109228852
5-(2,4-dimethoxyanilino)-N-(oxolan-2-ylmethyl)pyridine-3-carboxamide (PubChem CID 109228852) has the molecular formula C19H23N3O4 and a molecular weight of 357.41 g/mol. Its IUPAC name is 5-(2,4-dimethoxyanilino)-N-(oxolan-2-ylmethyl)pyridine-3-carboxamide.
| Compound Name | 5-(2,4-dimethoxyanilino)-N-(oxolan-2-ylmethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109228852 |
| Molecular Formula | C19H23N3O4 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 5-(2,4-dimethoxyanilino)-N-(oxolan-2-ylmethyl)pyridine-3-carboxamide |
| SMILES | COc1ccc(Nc2cncc(C(=O)NCC3CCCO3)c2)c(OC)c1 |
| InChI | InChI=1S/C19H23N3O4/c1-24-15-5-6-17(18(9-15)25-2)22-14-8-13(10-20-11-14)19(23)21-12-16-4-3-7-26-16/h5-6,8-11,16,22H,3-4,7,12H2,1-2H3,(H,21,23) |
| InChIKey | NHPPXCMDJNDXSW-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 81.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |