C17H17F2N3O2 — CID 109228908
5-(3,4-difluoroanilino)-N-(oxolan-2-ylmethyl)pyridine-3-carboxamide (PubChem CID 109228908) has the molecular formula C17H17F2N3O2 and a molecular weight of 333.34 g/mol. Its IUPAC name is 5-(3,4-difluoroanilino)-N-(oxolan-2-ylmethyl)pyridine-3-carboxamide.
| Compound Name | 5-(3,4-difluoroanilino)-N-(oxolan-2-ylmethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109228908 |
| Molecular Formula | C17H17F2N3O2 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 5-(3,4-difluoroanilino)-N-(oxolan-2-ylmethyl)pyridine-3-carboxamide |
| SMILES | O=C(NCC1CCCO1)c1cncc(Nc2ccc(F)c(F)c2)c1 |
| InChI | InChI=1S/C17H17F2N3O2/c18-15-4-3-12(7-16(15)19)22-13-6-11(8-20-9-13)17(23)21-10-14-2-1-5-24-14/h3-4,6-9,14,22H,1-2,5,10H2,(H,21,23) |
| InChIKey | ZBKJMJYNHPKTBS-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |