C19H23N3O4 — CID 109079502
2-N-butyl-4-N-(2,4-dimethoxyphenyl)pyridine-2,4-dicarboxamide (PubChem CID 109079502) has the molecular formula C19H23N3O4 and a molecular weight of 357.41 g/mol. Its IUPAC name is 2-N-butyl-4-N-(2,4-dimethoxyphenyl)pyridine-2,4-dicarboxamide.
| Compound Name | 2-N-butyl-4-N-(2,4-dimethoxyphenyl)pyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109079502 |
| Molecular Formula | C19H23N3O4 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 2-N-butyl-4-N-(2,4-dimethoxyphenyl)pyridine-2,4-dicarboxamide |
| SMILES | CCCCNC(=O)c1cc(C(=O)Nc2ccc(OC)cc2OC)ccn1 |
| InChI | InChI=1S/C19H23N3O4/c1-4-5-9-21-19(24)16-11-13(8-10-20-16)18(23)22-15-7-6-14(25-2)12-17(15)26-3/h6-8,10-12H,4-5,9H2,1-3H3,(H,21,24)(H,22,23) |
| InChIKey | NIWWFBUORABVMX-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|