C20H26N4O3 — CID 109084095
2-N-[3-(dimethylamino)propyl]-4-N-(4-ethoxyphenyl)pyridine-2,4-dicarboxamide (PubChem CID 109084095) has the molecular formula C20H26N4O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is 2-N-[3-(dimethylamino)propyl]-4-N-(4-ethoxyphenyl)pyridine-2,4-dicarboxamide.
| Compound Name | 2-N-[3-(dimethylamino)propyl]-4-N-(4-ethoxyphenyl)pyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109084095 |
| Molecular Formula | C20H26N4O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | 2-N-[3-(dimethylamino)propyl]-4-N-(4-ethoxyphenyl)pyridine-2,4-dicarboxamide |
| SMILES | CCOc1ccc(NC(=O)c2ccnc(C(=O)NCCCN(C)C)c2)cc1 |
| InChI | InChI=1S/C20H26N4O3/c1-4-27-17-8-6-16(7-9-17)23-19(25)15-10-12-21-18(14-15)20(26)22-11-5-13-24(2)3/h6-10,12,14H,4-5,11,13H2,1-3H3,(H,22,26)(H,23,25) |
| InChIKey | ZJJRBEZRWZYTCU-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|