C21H24N4O3 — CID 109084664
4-(4-formylpiperazine-1-carbonyl)-N-(3-phenylpropyl)pyridine-2-carboxamide (PubChem CID 109084664) has the molecular formula C21H24N4O3 and a molecular weight of 380.45 g/mol. Its IUPAC name is 4-(4-formylpiperazine-1-carbonyl)-N-(3-phenylpropyl)pyridine-2-carboxamide.
| Compound Name | 4-(4-formylpiperazine-1-carbonyl)-N-(3-phenylpropyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109084664 |
| Molecular Formula | C21H24N4O3 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 4-(4-formylpiperazine-1-carbonyl)-N-(3-phenylpropyl)pyridine-2-carboxamide |
| SMILES | O=CN1CCN(C(=O)c2ccnc(C(=O)NCCCc3ccccc3)c2)CC1 |
| InChI | InChI=1S/C21H24N4O3/c26-16-24-11-13-25(14-12-24)21(28)18-8-10-22-19(15-18)20(27)23-9-4-7-17-5-2-1-3-6-17/h1-3,5-6,8,10,15-16H,4,7,9,11-14H2,(H,23,27) |
| InChIKey | PWAPIFCRTQMYMP-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|