C20H23N3O4 — CID 109086973
4-N-(1,3-benzodioxol-5-ylmethyl)-2-N-pentylpyridine-2,4-dicarboxamide (PubChem CID 109086973) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is 4-N-(1,3-benzodioxol-5-ylmethyl)-2-N-pentylpyridine-2,4-dicarboxamide.
| Compound Name | 4-N-(1,3-benzodioxol-5-ylmethyl)-2-N-pentylpyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109086973 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 4-N-(1,3-benzodioxol-5-ylmethyl)-2-N-pentylpyridine-2,4-dicarboxamide |
| SMILES | CCCCCNC(=O)c1cc(C(=O)NCc2ccc3c(c2)OCO3)ccn1 |
| InChI | InChI=1S/C20H23N3O4/c1-2-3-4-8-22-20(25)16-11-15(7-9-21-16)19(24)23-12-14-5-6-17-18(10-14)27-13-26-17/h5-7,9-11H,2-4,8,12-13H2,1H3,(H,22,25)(H,23,24) |
| InChIKey | FXRKYCSEROVIKY-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|