C21H27N3O4 — CID 109088557
2-N-[(3,4-dimethoxyphenyl)methyl]-4-N-pentylpyridine-2,4-dicarboxamide (PubChem CID 109088557) has the molecular formula C21H27N3O4 and a molecular weight of 385.46 g/mol. Its IUPAC name is 2-N-[(3,4-dimethoxyphenyl)methyl]-4-N-pentylpyridine-2,4-dicarboxamide.
| Compound Name | 2-N-[(3,4-dimethoxyphenyl)methyl]-4-N-pentylpyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109088557 |
| Molecular Formula | C21H27N3O4 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | 2-N-[(3,4-dimethoxyphenyl)methyl]-4-N-pentylpyridine-2,4-dicarboxamide |
| SMILES | CCCCCNC(=O)c1ccnc(C(=O)NCc2ccc(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C21H27N3O4/c1-4-5-6-10-23-20(25)16-9-11-22-17(13-16)21(26)24-14-15-7-8-18(27-2)19(12-15)28-3/h7-9,11-13H,4-6,10,14H2,1-3H3,(H,23,25)(H,24,26) |
| InChIKey | HXDATPSLWRVJQB-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|