C20H25N3O4 — CID 109101964
3-N-butyl-5-N-[(3,4-dimethoxyphenyl)methyl]pyridine-3,5-dicarboxamide (PubChem CID 109101964) has the molecular formula C20H25N3O4 and a molecular weight of 371.44 g/mol. Its IUPAC name is 3-N-butyl-5-N-[(3,4-dimethoxyphenyl)methyl]pyridine-3,5-dicarboxamide.
| Compound Name | 3-N-butyl-5-N-[(3,4-dimethoxyphenyl)methyl]pyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 109101964 |
| Molecular Formula | C20H25N3O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | 3-N-butyl-5-N-[(3,4-dimethoxyphenyl)methyl]pyridine-3,5-dicarboxamide |
| SMILES | CCCCNC(=O)c1cncc(C(=O)NCc2ccc(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C20H25N3O4/c1-4-5-8-22-19(24)15-10-16(13-21-12-15)20(25)23-11-14-6-7-17(26-2)18(9-14)27-3/h6-7,9-10,12-13H,4-5,8,11H2,1-3H3,(H,22,24)(H,23,25) |
| InChIKey | ISIQIFFTUKMTFO-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|