C21H20N4O3 — CID 109087665
4-N-(2-ethoxyphenyl)-2-N-(pyridin-4-ylmethyl)pyridine-2,4-dicarboxamide (PubChem CID 109087665) has the molecular formula C21H20N4O3 and a molecular weight of 376.42 g/mol. Its IUPAC name is 4-N-(2-ethoxyphenyl)-2-N-(pyridin-4-ylmethyl)pyridine-2,4-dicarboxamide.
| Compound Name | 4-N-(2-ethoxyphenyl)-2-N-(pyridin-4-ylmethyl)pyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109087665 |
| Molecular Formula | C21H20N4O3 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 4-N-(2-ethoxyphenyl)-2-N-(pyridin-4-ylmethyl)pyridine-2,4-dicarboxamide |
| SMILES | CCOc1ccccc1NC(=O)c1ccnc(C(=O)NCc2ccncc2)c1 |
| InChI | InChI=1S/C21H20N4O3/c1-2-28-19-6-4-3-5-17(19)25-20(26)16-9-12-23-18(13-16)21(27)24-14-15-7-10-22-11-8-15/h3-13H,2,14H2,1H3,(H,24,27)(H,25,26) |
| InChIKey | KJBXRWASLPRUIC-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |