C21H27N3O3 — CID 109090577
4-N-(2-ethoxyphenyl)-2-N,2-N-dipropylpyridine-2,4-dicarboxamide (PubChem CID 109090577) has the molecular formula C21H27N3O3 and a molecular weight of 369.47 g/mol. Its IUPAC name is 4-N-(2-ethoxyphenyl)-2-N,2-N-dipropylpyridine-2,4-dicarboxamide.
| Compound Name | 4-N-(2-ethoxyphenyl)-2-N,2-N-dipropylpyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109090577 |
| Molecular Formula | C21H27N3O3 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | 4-N-(2-ethoxyphenyl)-2-N,2-N-dipropylpyridine-2,4-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)c1cc(C(=O)Nc2ccccc2OCC)ccn1 |
| InChI | InChI=1S/C21H27N3O3/c1-4-13-24(14-5-2)21(26)18-15-16(11-12-22-18)20(25)23-17-9-7-8-10-19(17)27-6-3/h7-12,15H,4-6,13-14H2,1-3H3,(H,23,25) |
| InChIKey | XSGDNRXSOXVCQY-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |