C20H20F3N3O2 — CID 109090330
4-(3-methylpiperidine-1-carbonyl)-N-[4-(trifluoromethyl)phenyl]pyridine-2-carboxamide (PubChem CID 109090330) has the molecular formula C20H20F3N3O2 and a molecular weight of 391.39 g/mol. Its IUPAC name is 4-(3-methylpiperidine-1-carbonyl)-N-[4-(trifluoromethyl)phenyl]pyridine-2-carboxamide.
| Compound Name | 4-(3-methylpiperidine-1-carbonyl)-N-[4-(trifluoromethyl)phenyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109090330 |
| Molecular Formula | C20H20F3N3O2 |
| Molecular Weight | 391.39 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | 4-(3-methylpiperidine-1-carbonyl)-N-[4-(trifluoromethyl)phenyl]pyridine-2-carboxamide |
| SMILES | CC1CCCN(C(=O)c2ccnc(C(=O)Nc3ccc(C(F)(F)F)cc3)c2)C1 |
| InChI | InChI=1S/C20H20F3N3O2/c1-13-3-2-10-26(12-13)19(28)14-8-9-24-17(11-14)18(27)25-16-6-4-15(5-7-16)20(21,22)23/h4-9,11,13H,2-3,10,12H2,1H3,(H,25,27) |
| InChIKey | WJJWEZWACJTNPD-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.39 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |