C17H19N3O2 — CID 109094464
2-N-(2-methylpropyl)-6-N-phenylpyridine-2,6-dicarboxamide (PubChem CID 109094464) has the molecular formula C17H19N3O2 and a molecular weight of 297.36 g/mol. Its IUPAC name is 2-N-(2-methylpropyl)-6-N-phenylpyridine-2,6-dicarboxamide.
| Compound Name | 2-N-(2-methylpropyl)-6-N-phenylpyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 109094464 |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 2-N-(2-methylpropyl)-6-N-phenylpyridine-2,6-dicarboxamide |
| SMILES | CC(C)CNC(=O)c1cccc(C(=O)Nc2ccccc2)n1 |
| InChI | InChI=1S/C17H19N3O2/c1-12(2)11-18-16(21)14-9-6-10-15(20-14)17(22)19-13-7-4-3-5-8-13/h3-10,12H,11H2,1-2H3,(H,18,21)(H,19,22) |
| InChIKey | XVIWAXRLOVZRJP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |