C9H16O2 — CID 10909819
(5R)-2,6-dimethylhept-3-yne-2,5-diol (PubChem CID 10909819) has the molecular formula C9H16O2 and a molecular weight of 156.22 g/mol. Its IUPAC name is (5R)-2,6-dimethylhept-3-yne-2,5-diol.
| Compound Name | (5R)-2,6-dimethylhept-3-yne-2,5-diol |
|---|---|
| PubChem CID | 10909819 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | (5R)-2,6-dimethylhept-3-yne-2,5-diol |
| SMILES | CC(C)[C@@H](O)C#CC(C)(C)O |
| InChI | InChI=1S/C9H16O2/c1-7(2)8(10)5-6-9(3,4)11/h7-8,10-11H,1-4H3/t8-/m0/s1 |
| InChIKey | QUUIEUHVHMNXRT-QMMMGPOBSA-N |
| XLogP | 0.78 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|