C20H12F2N4O2 — CID 109101113
2-N-(3-cyanophenyl)-6-N-(2,6-difluorophenyl)pyridine-2,6-dicarboxamide (PubChem CID 109101113) has the molecular formula C20H12F2N4O2 and a molecular weight of 378.34 g/mol. Its IUPAC name is 2-N-(3-cyanophenyl)-6-N-(2,6-difluorophenyl)pyridine-2,6-dicarboxamide.
| Compound Name | 2-N-(3-cyanophenyl)-6-N-(2,6-difluorophenyl)pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 109101113 |
| Molecular Formula | C20H12F2N4O2 |
| Molecular Weight | 378.34 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | 2-N-(3-cyanophenyl)-6-N-(2,6-difluorophenyl)pyridine-2,6-dicarboxamide |
| SMILES | N#Cc1cccc(NC(=O)c2cccc(C(=O)Nc3c(F)cccc3F)n2)c1 |
| InChI | InChI=1S/C20H12F2N4O2/c21-14-6-2-7-15(22)18(14)26-20(28)17-9-3-8-16(25-17)19(27)24-13-5-1-4-12(10-13)11-23/h1-10H,(H,24,27)(H,26,28) |
| InChIKey | WOTLAPGFHIAABY-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 94.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.34 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |