C23H23N3O3 — CID 109101290
5-N-(4-phenylmethoxyphenyl)-3-N-propylpyridine-3,5-dicarboxamide (PubChem CID 109101290) has the molecular formula C23H23N3O3 and a molecular weight of 389.46 g/mol. Its IUPAC name is 5-N-(4-phenylmethoxyphenyl)-3-N-propylpyridine-3,5-dicarboxamide.
| Compound Name | 5-N-(4-phenylmethoxyphenyl)-3-N-propylpyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 109101290 |
| Molecular Formula | C23H23N3O3 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 5-N-(4-phenylmethoxyphenyl)-3-N-propylpyridine-3,5-dicarboxamide |
| SMILES | CCCNC(=O)c1cncc(C(=O)Nc2ccc(OCc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C23H23N3O3/c1-2-12-25-22(27)18-13-19(15-24-14-18)23(28)26-20-8-10-21(11-9-20)29-16-17-6-4-3-5-7-17/h3-11,13-15H,2,12,16H2,1H3,(H,25,27)(H,26,28) |
| InChIKey | QDQRPZNSQGETEF-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |